https://wiki.sarg.dev/api.php?action=feedcontributions&feedformat=atom&user=116.98.218.118 Vero - Wikipedia - User contributions [en] 2026-07-10T18:19:50Z User contributions MediaWiki 1.44.2 https://wiki.sarg.dev/index.php?title=Sorbose&diff=320483 Sorbose 2024-05-18T01:54:52Z <p>116.98.218.118: </p> <hr /> <div>{{Chembox<br /> | Verifiedfields = changed<br /> | Watchedfields = changed<br /> | verifiedrevid = 450955931<br /> | ImageFileL1 = L-sorbose_Fischer.png<br /> | ImageSizeL1 = 75px<br /> | ImageFileR1 = sorbose.png<br /> | ImageSizeR1 = 150px<br /> | IUPACName = &lt;small&gt;L&lt;/small&gt;-''xylo''-Hex-2-ulose<br /> | OtherNames = Sorbinose&lt;br&gt;&lt;small&gt;L&lt;/small&gt;-''xylo''-Hexulose<br /> | SystematicName = (''3S,4R,5S'')-1,3,4,5,6-Pentahydroxyhexan-2-one<br /> | Section1 = {{Chembox Identifiers<br /> |CASNo_Ref = {{cascite|correct|CAS}}<br /> |CASNo=87-79-6<br /> |UNII_Ref = {{fdacite|correct|FDA}}<br /> |UNII = NV2001607Y<br /> |PubChem=6904<br /> |ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}<br /> |ChemSpiderID = 6638<br /> |InChI = 1/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m0/s1<br /> |InChIKey = BJHIKXHVCXFQLS-OTWZMJIIBK<br /> |StdInChI_Ref = {{stdinchicite|changed|chemspider}}<br /> |StdInChI = 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m0/s1<br /> |StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}<br /> |StdInChIKey = BJHIKXHVCXFQLS-OTWZMJIISA-N<br /> |SMILES=C([C@@H]([C@H]([C@@H](C(=O)CO)O)O)O)O<br /> }}<br /> | Section2 = {{Chembox Properties<br /> |Properties_ref = &lt;ref name=Merck&gt;''[[Merck Index]]'', 12th Edition, '''8874'''&lt;/ref&gt;<br /> |C=6 | H=12 | O=6<br /> |Appearance=white solid<br /> |Density=1.65 g/cm&lt;sup&gt;3&lt;/sup&gt; (15 °C)<br /> |MeltingPtC=165<br /> |Solubility=Highly Soluble <br /> }}<br /> }}<br /> <br /> '''Sorbose''' is a [[ketose]] belonging to the group of [[sugar]]s known as [[monosaccharide]]s. It has a sweetness that is equivalent to [[sucrose]] (table sugar).&lt;ref name=Merck/&gt; The commercial production of [[vitamin C]] ([[ascorbic acid]]) often begins with sorbose. &lt;small&gt;L&lt;/small&gt;-Sorbose is the configuration of the naturally occurring sugar. It can be prepared from inexpensive O-benzylglucose. <br /> <br /> ==Synthesis==<br /> Under conditions employed for a [[Meerwein-Ponndorf-Verley reduction]], the tetra-O-benzyl aldose converts to tetra-''O''-benzylsorbose. [[Hydrogenolysis]] removes the four [[benzyl group]]s, leaving sorbose.&lt;ref&gt;{{cite journal |doi=10.1021/acs.chemrev.5b00104 |title=Synthesis of l-Hexoses |year=2015 |last1=Frihed |first1=Tobias Gylling |last2=Bols |first2=Mikael |last3=Pedersen |first3=Christian Marcus |journal=Chemical Reviews |volume=115 |issue=9 |pages=3615–3676 |pmid=25893557 }}&lt;/ref&gt;<br /> <br /> ==References==<br /> {{reflist}}<br /> <br /> {{Carbohydrates}}<br /> <br /> {{ketone-stub}}<br /> [[Category:Ketohexoses]]</div> 116.98.218.118