View source for Clobetasol

{{Short description|Chemical compound}}
{{Distinguish|Clobetasol propionate}}
{{Drugbox
| IUPAC_name = (8''S'',9''R'',10''S'',11''S'',13''S'',14''S'',16''S'',17''R'')-17-(2-Chloroacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[''a'']phenanthren-3-one
| image = Clobetasol.svg
| width = 

<!--Clinical data-->
| tradename =
| pregnancy_AU = B3
| pregnancy_AU_comment = <ref>{{cite web | title=Updates to the Prescribing Medicines in Pregnancy database | website=Therapeutic Goods Administration (TGA) | date=21 December 2022 | url=https://www.tga.gov.au/resources/resource/guidance/updates-prescribing-medicines-pregnancy-database | access-date=2 January 2023 | archive-date=3 April 2022 | archive-url=https://web.archive.org/web/20220403064059/https://www.tga.gov.au/updates-prescribing-medicines-pregnancy-database | url-status=live }}</ref>
| pregnancy_category = 
| routes_of_administration = 
| class = [[Corticosteroid]]; [[Glucocorticoid]]
| ATC_prefix = None <!-- Scheduled to be S01BA17 in 2026 -->
| ATC_suffix = 
| ATC_supplemental = 

| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = 
| CAS_number = 25122-41-2
| CAS_supplemental = 
| PubChem = 5311051
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 4470588
| UNII = ADN79D536H
| KEGG = 
| ChEBI = 
| ChEMBL = 

<!--Chemical data-->
| C=22 | H=28 | Cl=1 | F=1 | O=4
| SMILES = C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CCl)O)C)O)F)C
| StdInChI_Ref = 
| StdInChI = 1S/C22H28ClFO4/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,24)17(26)10-20(16,3)22(12,28)18(27)11-23/h6-7,9,12,15-17,26,28H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17-,19-,20-,21-,22-/m0/s1
| StdInChIKey_Ref = 
| StdInChIKey = FCSHDIVRCWTZOX-DVTGEIKXSA-N
| synonyms = 9α-Fluoro-11β,17α-dihydroxy-16β-methyl-21-chloropregna-1,4-diene-3,20-dione
}}

'''Clobetasol''' is a [[synthetic compound|synthetic]] [[glucocorticoid]] [[corticosteroid]]. A [[propionate]] [[ester]] of clobetasol, [[clobetasol propionate]], has also been marketed, and is far more widely used in comparison.<ref name="Elks2014">{{cite book| veditors = Elks J, Ganellin CR |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA292|date=14 November 2014|publisher=Springer|doi=10.1007/978-1-4757-2085-3|isbn=978-1-4757-2085-3|pages=292–}}</ref><ref name="IndexNominum2000">{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA252|year=2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=252–}}</ref>

==References==
{{Reflist|2}}

{{Glucocorticoids and antiglucocorticoids}}
{{Glucocorticoid receptor modulators}}

[[Category:Diketones]]
[[Category:Diols]]
[[Category:Organofluorides]]
[[Category:Glucocorticoids]]
[[Category:Organochlorides]]
[[Category:Pregnanes]]


{{Pregnanes-stub}}