View source for Flavone

{{Chembox
| ImageFile      = Flavon num.svg
| ImageSize      = 220px
| ImageClass     = skin-invert
| IUPACName      = Flavone<ref>https://iupac.qmul.ac.uk/flavonoid/index.html#Flv321</ref>
| OtherNames     = 
| SystematicName = 2-Phenyl-4''H''-1-benzopyran-4-one<br>
2-Phenyl-4''H''-chromen-4-one
| Section1       = {{Chembox Identifiers
| CASNo = 525-82-6
| CASNo_Ref = {{Cascite|correct|CAS}}
| Beilstein = 157598
| ChEBI = 42491
| ChEMBL = 275638
| ChemSpiderID = 10230
| DrugBank = DB07776
| EC_number = 208-383-8
| Gmelin = 1224858
| IUPHAR_ligand = 409
| KEGG = C15608
| PubChem = 10680
| RTECS = DJ3100630
| UNII = S2V45N7G3B
| StdInChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H
| StdInChIKey = VHBFFQKBGNRLFZ-UHFFFAOYSA-N
| SMILES = C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2
 }}
| Section2       = {{Chembox Properties
| C = 15|O=2|H=10
| MolarMass =
| Appearance = white solid
| Density = 
| MeltingPtC = 96-97
| BoilingPt = 
| Solubility = }}
| Section3       = {{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = }}
}}
'''Flavone''' is an [[organic compound]] with the formula {{chem2|C6H4OC3H(Ph)O}}. A white solid, flavone is a derivative of [[chromone]] with a [[phenyl]] (Ph) substituent adjacent to the ether group.  The compound is of little direct practical importance, but substituted derivatives, the [[flavones]] and  [[flavonoids]] are a large class of nutritionally important [[natural product]]s.<ref>{{cite journal |doi=10.1021/cr400265z|title=Chromone: A Valid Scaffold in Medicinal Chemistry |year=2014 |last1=Gaspar |first1=Alexandra |last2=Matos |first2=Maria João |last3=Garrido |first3=Jorge |last4=Uriarte |first4=Eugenio |last5=Borges |first5=Fernanda |journal=Chemical Reviews |volume=114 |issue=9 |pages=4960–4992 |url=https://repositorio-aberto.up.pt/handle/10216/70808 |url-access=subscription }}</ref> Flavone can be prepared in the laboratory by cyclization of 2-hydrox[[acetophenone]].<ref>{{cite journal |doi=10.15227/orgsyn.032.0072|title=Flavone |journal=Organic Syntheses |year=1952 |volume=32 |page=72|author=T. S. Wheeler }}</ref>  Isomeric with flavone is [[isoflavone]], where the phenyl group is adjacent to the [[ketone]].

==References==
<references />

{{Flavones}}

[[Category:Flavones| ]]