https://wiki.sarg.dev/index.php?action=history&feed=atom&title=Triprolidine
Triprolidine - Revision history
2026-06-23T22:11:33Z
Revision history for this page on the wiki
MediaWiki 1.44.2
https://wiki.sarg.dev/index.php?title=Triprolidine&diff=104502&oldid=prev
imported>TooManyFingers: Moved patent date and medical use date upwards. Are those really "society and culture" material? I left that note attached to them anyway.
2025-10-26T15:37:30Z
<p>Moved patent date and medical use date upwards. Are those really "society and culture" material? I left that note attached to them anyway.</p>
<p><b>New page</b></p><div>{{Short description|Antihistamine medication}}<br />
{{cs1 config|name-list-style=vanc}}<br />
{{About|the drug|the Roman province|Tripolitania|the city|Tripoli (disambiguation){{!}}Tripoli}}<br />
{{drugbox<br />
| Verifiedfields = changed<br />
| Watchedfields = changed<br />
| verifiedrevid = 470617213<br />
| IUPAC_name = 2-[(''E'')-1-(4-methylphenyl)-3-pyrrolidin-1-yl-<br />prop-1-enyl]pyridine<br />
| image = Triprolidine Structural Formula V1.svg<br />
| image_class = skin-invert-image<br />
| tradename = Flonase Nighttime Allergy Relief, Actidil, others<br />
<!--Clinical data-->| Drugs.com = {{drugs.com|monograph|triprolidine-hydrochloride}}<br />
| pregnancy_category = C (US)<br />
| legal_US = otc<br />
| routes_of_administration = [[By mouth]]<br />
<!--Pharmacokinetic data-->| bioavailability = Oral: 4%<br />
| protein_bound = 90%<br />
| metabolism = [[Hepatic]] ([[CYP2D6]])<br />
| elimination_half-life = 4–6 hours<br />
| excretion = [[Renal]]<br />
<!--Identifiers-->| CAS_number_Ref = {{cascite|correct|??}}<br />
| CAS_number = 486-12-4<br />
| ATC_prefix = R06<br />
| ATC_suffix = AX07<br />
| PubChem = 5282443<br />
| IUPHAR_ligand = 1228<br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| DrugBank = DB00427<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| ChemSpiderID = 4445597<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| UNII = 2L8T9S52QM<br />
| KEGG_Ref = {{keggcite|changed|kegg}}<br />
| KEGG = D01782<br />
| ChEBI_Ref = {{ebicite|changed|EBI}}<br />
| ChEBI = 84116<br />
| ChEMBL_Ref = {{ebicite|correct|EBI}}<br />
| ChEMBL = 855<br />
<!--Chemical data-->| C = 19<br />
| H = 22<br />
| N = 2<br />
| SMILES = n3c(\C(=C\CN1CCCC1)c2ccc(cc2)C)cccc3<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChI = 1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChIKey = CBEQULMOCCWAQT-WOJGMQOQSA-N<br />
| melting_point = 60<br />
| solubility = 500<br />
}}<br />
<!-- Definition and medical uses --><br />
'''Triprolidine''' is an [[Over-the-counter drug|over-the-counter]] [[antihistamine]] with [[anticholinergic]] properties.<ref name="Goldsmith">{{cite journal | vauthors = Goldsmith P, Dowd PM | title = The new H1 antihistamines. Treatment of urticaria and other clinical problems | journal = Dermatologic Clinics | volume = 11 | issue = 1 | pages = 87–95 | date = January 1993 | doi = 10.1016/S0733-8635(18)30285-7 | pmid = 8094649 }}</ref> It is used to combat the symptoms associated with [[allergy|allergies]] and is sometimes combined with other [[common cold|cold]] medications designed to provide general relief for [[influenza|flu]]-like symptoms.<ref>{{cite journal | vauthors = Williams BO, Liao SH, Lai AA, Arnold JD, Perkins JG, Blum MR, Findlay JW | title = Bioavailability of pseudoephedrine and triprolidine from combination and single-ingredient products | journal = Clinical Pharmacy | volume = 3 | issue = 6 | pages = 638–43 | year = 1984 | pmid = 6509877 }}</ref> As with many antihistamines, the most common [[Adverse effect (medicine)|side effect]] is drowsiness.<ref name="Goldsmith" /><br />
<br />
<!-- Society and culture --><br />
Triprolidine was patented in 1948 and came into medical use in 1953,<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title= Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=546 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA546 |language=en}}</ref> and has mostly been replaced in popular medications by other antihistamines including [[diphenhydramine]], [[promethazine]], [[chlorpheniramine]], as well as by [[Second generation antihistamines|second-generation antihistamines]] including [[loratadine]] and [[fexofenadine]]. Triprolidine remains an ingredient in the cold medicine [[Actifed]] in many territories.{{Citation needed|date=March 2025}}<br />
<br />
== See also ==<br />
*[[Benzatropine]]<br />
*[[Pseudoephedrine]]<br />
<br />
== References ==<br />
{{Reflist}}<br />
<br />
{{Antihistamines}}<br />
{{Hallucinogens}}<br />
{{Histamine receptor modulators}}<br />
{{Muscarinic acetylcholine receptor modulators}}<br />
<br />
[[Category:Alkene derivatives]]<br />
[[Category:H1 receptor antagonists]]<br />
[[Category:Muscarinic antagonists]]<br />
[[Category:2-Pyridyl compounds]]<br />
[[Category:1-Pyrrolidinyl compounds]]<br />
[[Category:4-Tolyl compounds]]<br />
[[Category:Over-the-counter drugs in the United States]]</div>
imported>TooManyFingers